C16H32N2O6 — CID 139337163
N,N'-bis(2-hydroxyethyl)-N,N'-bis(2-hydroxypropyl)hexanediamide (PubChem CID 139337163) has the molecular formula C16H32N2O6 and a molecular weight of 348.44 g/mol. Its IUPAC name is N,N'-bis(2-hydroxyethyl)-N,N'-bis(2-hydroxypropyl)hexanediamide.
| Compound Name | N,N'-bis(2-hydroxyethyl)-N,N'-bis(2-hydroxypropyl)hexanediamide |
|---|---|
| PubChem CID | 139337163 |
| Molecular Formula | C16H32N2O6 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N,N'-bis(2-hydroxyethyl)-N,N'-bis(2-hydroxypropyl)hexanediamide |
| SMILES | CC(O)CN(CCO)C(=O)CCCCC(=O)N(CCO)CC(C)O |
| InChI | InChI=1S/C16H32N2O6/c1-13(21)11-17(7-9-19)15(23)5-3-4-6-16(24)18(8-10-20)12-14(2)22/h13-14,19-22H,3-12H2,1-2H3 |
| InChIKey | RTNBYZDOKQADEA-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|