C11H22N2O4 — CID 169291277
N',N'-bis(2-hydroxyethyl)-N,N-dimethylpentanediamide (PubChem CID 169291277) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is N',N'-bis(2-hydroxyethyl)-N,N-dimethylpentanediamide.
| Compound Name | N',N'-bis(2-hydroxyethyl)-N,N-dimethylpentanediamide |
|---|---|
| PubChem CID | 169291277 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N',N'-bis(2-hydroxyethyl)-N,N-dimethylpentanediamide |
| SMILES | CN(C)C(=O)CCCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C11H22N2O4/c1-12(2)10(16)4-3-5-11(17)13(6-8-14)7-9-15/h14-15H,3-9H2,1-2H3 |
| InChIKey | YVIUSANASRJVKB-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |