C11H24N2O2 — CID 62015425
4-[2-hydroxyethyl(propyl)amino]-N,N-dimethylbutanamide (PubChem CID 62015425) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(propyl)amino]-N,N-dimethylbutanamide.
| Compound Name | 4-[2-hydroxyethyl(propyl)amino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 62015425 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 4-[2-hydroxyethyl(propyl)amino]-N,N-dimethylbutanamide |
| SMILES | CCCN(CCO)CCCC(=O)N(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-4-7-13(9-10-14)8-5-6-11(15)12(2)3/h14H,4-10H2,1-3H3 |
| InChIKey | YWWQNYUECAGAAP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |