C8H18N2O3 — CID 60686826
2-[bis(2-hydroxyethyl)amino]-N,N-dimethylacetamide (PubChem CID 60686826) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60686826 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(CCO)CCO |
| InChI | InChI=1S/C8H18N2O3/c1-9(2)8(13)7-10(3-5-11)4-6-12/h11-12H,3-7H2,1-2H3 |
| InChIKey | IUZAFQNNECZYSJ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |