About 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide
2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide (PubChem CID 135183389) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide.
Analyze 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide (CID 135183389) is 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide is CCN(CCOC)CC(=O)N(C)C.
What is the InChIKey of 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide?
The InChIKey is IHPIQISORRXNFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-5-11(6-7-13-4)8-9(12)10(2)3/h5-8H2,1-4H3.
What are the key properties of 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide?
2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide has a molecular weight of 188.27 g/mol, XLogP of 0.04, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(2-methoxyethyl)amino]-N,N-dimethylacetamide is sourced from PubChem (CID 135183389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).