ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate

C11H25NO3 — CID 156838372

IUPACethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate
SMILESCC.CCOC(=O)CN(CC)CCOC
InChIInChI=1S/C9H19NO3.C2H6/c1-4-10(6-7-12-3)8-9(11)13-5-2;1-2/h4-8H2,1-3H3;1-2H3
InChIKeyKKNAEXMBGKQWOW-UHFFFAOYSA-N
MW219.32 g/mol
LogP1.54
Rot. Bonds7

About ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate

ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate (PubChem CID 156838372) has the molecular formula C11H25NO3 and a molecular weight of 219.32 g/mol. Its IUPAC name is ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate.

Molecular Properties

Compound Nameethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate
PubChem CID156838372
Molecular FormulaC11H25NO3
Molecular Weight219.32 g/mol
Exact Mass219.18
IUPAC Nameethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate
SMILESCC.CCOC(=O)CN(CC)CCOC
InChIInChI=1S/C9H19NO3.C2H6/c1-4-10(6-7-12-3)8-9(11)13-5-2;1-2/h4-8H2,1-3H3;1-2H3
InChIKeyKKNAEXMBGKQWOW-UHFFFAOYSA-N
XLogP1.54
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.32
LogP ≤ 51.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate?
The IUPAC name of ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate (CID 156838372) is ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate.
What is the SMILES notation for ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate?
The canonical SMILES for ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate is CC.CCOC(=O)CN(CC)CCOC.
What is the InChIKey of ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate?
The InChIKey is KKNAEXMBGKQWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3.C2H6/c1-4-10(6-7-12-3)8-9(11)13-5-2;1-2/h4-8H2,1-3H3;1-2H3.
What are the key properties of ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate?
ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate has a molecular weight of 219.32 g/mol, XLogP of 1.54, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-[ethyl(2-methoxyethyl)amino]acetate is sourced from PubChem (CID 156838372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).