About 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide
2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide (PubChem CID 43137216) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide.
Analyze 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide (CID 43137216) is 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide is CCN(CCCN)CC(=O)N(C)C.
What is the InChIKey of 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide?
The InChIKey is VHJVVIIOOHSRBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O/c1-4-12(7-5-6-10)8-9(13)11(2)3/h4-8,10H2,1-3H3.
What are the key properties of 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide?
2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide has a molecular weight of 187.29 g/mol, XLogP of -0.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-aminopropyl(ethyl)amino]-N,N-dimethylacetamide is sourced from PubChem (CID 43137216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).