C7H19N3 — CID 55289486
N'-(2-aminoethyl)-N'-ethylpropane-1,3-diamine (PubChem CID 55289486) has the molecular formula C7H19N3 and a molecular weight of 145.25 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-ethylpropane-1,3-diamine.
| Compound Name | N'-(2-aminoethyl)-N'-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 55289486 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | N'-(2-aminoethyl)-N'-ethylpropane-1,3-diamine |
| SMILES | CCN(CCN)CCCN |
| InChI | InChI=1S/C7H19N3/c1-2-10(7-5-9)6-3-4-8/h2-9H2,1H3 |
| InChIKey | LQZGZKARCBFBKD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |