C6H16N2S — CID 145098138
2-[2-aminoethyl(ethyl)amino]ethanethiol (PubChem CID 145098138) has the molecular formula C6H16N2S and a molecular weight of 148.28 g/mol. Its IUPAC name is 2-[2-aminoethyl(ethyl)amino]ethanethiol.
| Compound Name | 2-[2-aminoethyl(ethyl)amino]ethanethiol |
|---|---|
| PubChem CID | 145098138 |
| Molecular Formula | C6H16N2S |
| Molecular Weight | 148.28 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-[2-aminoethyl(ethyl)amino]ethanethiol |
| SMILES | CCN(CCN)CCS |
| InChI | InChI=1S/C6H16N2S/c1-2-8(4-3-7)5-6-9/h9H,2-7H2,1H3 |
| InChIKey | RHNCSOVSTXBRIC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|