About 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride
2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride (PubChem CID 174516424) has the molecular formula C8H24Cl2N2S2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride.
Molecular Properties
| Compound Name | 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride |
| PubChem CID | 174516424 |
| Molecular Formula | C8H24Cl2N2S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride |
| SMILES | CCN(CC)CCS.Cl.Cl.NCCS |
| InChI | InChI=1S/C6H15NS.C2H7NS.2ClH/c1-3-7(4-2)5-6-8;3-1-2-4;;/h8H,3-6H2,1-2H3;4H,1-3H2;2*1H |
| InChIKey | JBSKWZFFKIPURR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride?
The IUPAC name of 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride (CID 174516424) is 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride.
What is the SMILES notation for 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride?
The canonical SMILES for 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride is CCN(CC)CCS.Cl.Cl.NCCS.
What is the InChIKey of 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride?
The InChIKey is JBSKWZFFKIPURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NS.C2H7NS.2ClH/c1-3-7(4-2)5-6-8;3-1-2-4;;/h8H,3-6H2,1-2H3;4H,1-3H2;2*1H.
What are the key properties of 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride?
2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride has a molecular weight of 283.33 g/mol, XLogP of 1.98, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanethiol;2-(diethylamino)ethanethiol;dihydrochloride is sourced from PubChem (CID 174516424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).