C16H42N6 — CID 87350577
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;N,N,N',N'-tetraethylethane-1,2-diamine (PubChem CID 87350577) has the molecular formula C16H42N6 and a molecular weight of 318.55 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;N,N,N',N'-tetraethylethane-1,2-diamine.
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;N,N,N',N'-tetraethylethane-1,2-diamine |
|---|---|
| PubChem CID | 87350577 |
| Molecular Formula | C16H42N6 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.35 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;N,N,N',N'-tetraethylethane-1,2-diamine |
| SMILES | CCN(CC)CCN(CC)CC.NCCNCCNCCN |
| InChI | InChI=1S/C10H24N2.C6H18N4/c1-5-11(6-2)9-10-12(7-3)8-4;7-1-3-9-5-6-10-4-2-8/h5-10H2,1-4H3;9-10H,1-8H2 |
| InChIKey | NATIOJGOABIBFG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|