C18H41N3 — CID 23131522
N-[5-(diethylamino)pentyl]-N',N'-diethylpentane-1,5-diamine (PubChem CID 23131522) has the molecular formula C18H41N3 and a molecular weight of 299.55 g/mol. Its IUPAC name is N-[5-(diethylamino)pentyl]-N',N'-diethylpentane-1,5-diamine.
| Compound Name | N-[5-(diethylamino)pentyl]-N',N'-diethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 23131522 |
| Molecular Formula | C18H41N3 |
| Molecular Weight | 299.55 g/mol |
| Exact Mass | 299.33 |
| IUPAC Name | N-[5-(diethylamino)pentyl]-N',N'-diethylpentane-1,5-diamine |
| SMILES | CCN(CC)CCCCCNCCCCCN(CC)CC |
| InChI | InChI=1S/C18H41N3/c1-5-20(6-2)17-13-9-11-15-19-16-12-10-14-18-21(7-3)8-4/h19H,5-18H2,1-4H3 |
| InChIKey | FMXSSAZUVCXKLS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|