C12H27BrN2 — CID 107914108
N-(6-bromohexyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 107914108) has the molecular formula C12H27BrN2 and a molecular weight of 279.27 g/mol. Its IUPAC name is N-(6-bromohexyl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(6-bromohexyl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 107914108 |
| Molecular Formula | C12H27BrN2 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-(6-bromohexyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCCCCCBr |
| InChI | InChI=1S/C12H27BrN2/c1-3-15(4-2)12-11-14-10-8-6-5-7-9-13/h14H,3-12H2,1-2H3 |
| InChIKey | PVPKZRVPDQISHB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|