C10H24N2S — CID 28615454
N',N'-diethyl-N-(3-methylsulfanylpropyl)ethane-1,2-diamine (PubChem CID 28615454) has the molecular formula C10H24N2S and a molecular weight of 204.38 g/mol. Its IUPAC name is N',N'-diethyl-N-(3-methylsulfanylpropyl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(3-methylsulfanylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 28615454 |
| Molecular Formula | C10H24N2S |
| Molecular Weight | 204.38 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | N',N'-diethyl-N-(3-methylsulfanylpropyl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCCSC |
| InChI | InChI=1S/C10H24N2S/c1-4-12(5-2)9-8-11-7-6-10-13-3/h11H,4-10H2,1-3H3 |
| InChIKey | QOSWNIZVUIWZJN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|