C11H28N2 — CID 157059256
propane;N,N',N'-triethylethane-1,2-diamine (PubChem CID 157059256) has the molecular formula C11H28N2 and a molecular weight of 188.36 g/mol. Its IUPAC name is propane;N,N',N'-triethylethane-1,2-diamine.
| Compound Name | propane;N,N',N'-triethylethane-1,2-diamine |
|---|---|
| PubChem CID | 157059256 |
| Molecular Formula | C11H28N2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.23 |
| IUPAC Name | propane;N,N',N'-triethylethane-1,2-diamine |
| SMILES | CCC.CCNCCN(CC)CC |
| InChI | InChI=1S/C8H20N2.C3H8/c1-4-9-7-8-10(5-2)6-3;1-3-2/h9H,4-8H2,1-3H3;3H2,1-2H3 |
| InChIKey | ABCYJILAROPTIM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|