C9H24N2 — CID 142004273
N',N'-diethyl-N-methylethane-1,2-diamine;ethane (PubChem CID 142004273) has the molecular formula C9H24N2 and a molecular weight of 160.30 g/mol. Its IUPAC name is N',N'-diethyl-N-methylethane-1,2-diamine;ethane.
| Compound Name | N',N'-diethyl-N-methylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 142004273 |
| Molecular Formula | C9H24N2 |
| Molecular Weight | 160.30 g/mol |
| Exact Mass | 160.19 |
| IUPAC Name | N',N'-diethyl-N-methylethane-1,2-diamine;ethane |
| SMILES | CC.CCN(CC)CCNC |
| InChI | InChI=1S/C7H18N2.C2H6/c1-4-9(5-2)7-6-8-3;1-2/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | HBMSLBSBZXOCHY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |