C11H29N5 — CID 139553651
N'-[[2-[3-(dimethylamino)propyl]hydrazinyl]methyl]-N'-ethyl-N-methylethane-1,2-diamine (PubChem CID 139553651) has the molecular formula C11H29N5 and a molecular weight of 231.39 g/mol. Its IUPAC name is N'-[[2-[3-(dimethylamino)propyl]hydrazinyl]methyl]-N'-ethyl-N-methylethane-1,2-diamine.
| Compound Name | N'-[[2-[3-(dimethylamino)propyl]hydrazinyl]methyl]-N'-ethyl-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 139553651 |
| Molecular Formula | C11H29N5 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.24 |
| IUPAC Name | N'-[[2-[3-(dimethylamino)propyl]hydrazinyl]methyl]-N'-ethyl-N-methylethane-1,2-diamine |
| SMILES | CCN(CCNC)CNNCCCN(C)C |
| InChI | InChI=1S/C11H29N5/c1-5-16(10-8-12-2)11-14-13-7-6-9-15(3)4/h12-14H,5-11H2,1-4H3 |
| InChIKey | XDNWQVDAWNXAND-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|