C11H30N2 — CID 156874721
N',N'-diethyl-N-methylpropane-1,3-diamine;molecular hydrogen;propane (PubChem CID 156874721) has the molecular formula C11H30N2 and a molecular weight of 190.38 g/mol. Its IUPAC name is N',N'-diethyl-N-methylpropane-1,3-diamine;molecular hydrogen;propane.
| Compound Name | N',N'-diethyl-N-methylpropane-1,3-diamine;molecular hydrogen;propane |
|---|---|
| PubChem CID | 156874721 |
| Molecular Formula | C11H30N2 |
| Molecular Weight | 190.38 g/mol |
| Exact Mass | 190.24 |
| IUPAC Name | N',N'-diethyl-N-methylpropane-1,3-diamine;molecular hydrogen;propane |
| SMILES | CCC.CCN(CC)CCCNC.[H][H] |
| InChI | InChI=1S/C8H20N2.C3H8.H2/c1-4-10(5-2)8-6-7-9-3;1-3-2;/h9H,4-8H2,1-3H3;3H2,1-2H3;1H |
| InChIKey | OFVRAIFGJPJFCT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|