C9H23N3 — CID 142226092
N'-ethyl-N-methyl-N'-[2-(methylamino)ethyl]propane-1,3-diamine (PubChem CID 142226092) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N'-[2-(methylamino)ethyl]propane-1,3-diamine.
| Compound Name | N'-ethyl-N-methyl-N'-[2-(methylamino)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 142226092 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N'-ethyl-N-methyl-N'-[2-(methylamino)ethyl]propane-1,3-diamine |
| SMILES | CCN(CCCNC)CCNC |
| InChI | InChI=1S/C9H23N3/c1-4-12(9-7-11-3)8-5-6-10-2/h10-11H,4-9H2,1-3H3 |
| InChIKey | LUZHZNBQSUJMHG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|