C10H23N3 — CID 89212435
N'-ethyl-N-methyl-N'-[3-(methylideneamino)propyl]propane-1,3-diamine (PubChem CID 89212435) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N'-[3-(methylideneamino)propyl]propane-1,3-diamine.
| Compound Name | N'-ethyl-N-methyl-N'-[3-(methylideneamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 89212435 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | N'-ethyl-N-methyl-N'-[3-(methylideneamino)propyl]propane-1,3-diamine |
| SMILES | C=NCCCN(CC)CCCNC |
| InChI | InChI=1S/C10H23N3/c1-4-13(9-5-7-11-2)10-6-8-12-3/h12H,2,4-10H2,1,3H3 |
| InChIKey | UVWYFMDJCZISLG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|