C9H22N2O — CID 58803335
N'-(2-ethoxyethyl)-N'-ethyl-N-methylethane-1,2-diamine (PubChem CID 58803335) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is N'-(2-ethoxyethyl)-N'-ethyl-N-methylethane-1,2-diamine.
| Compound Name | N'-(2-ethoxyethyl)-N'-ethyl-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 58803335 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | N'-(2-ethoxyethyl)-N'-ethyl-N-methylethane-1,2-diamine |
| SMILES | CCOCCN(CC)CCNC |
| InChI | InChI=1S/C9H22N2O/c1-4-11(7-6-10-3)8-9-12-5-2/h10H,4-9H2,1-3H3 |
| InChIKey | BFRKCYCYMQFLJR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|