C23H50N2O5 — CID 174152095
N'-(2-butoxyethyl)-N'-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl]-N-methylhexane-1,6-diamine (PubChem CID 174152095) has the molecular formula C23H50N2O5 and a molecular weight of 434.66 g/mol. Its IUPAC name is N'-(2-butoxyethyl)-N'-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl]-N-methylhexane-1,6-diamine.
| Compound Name | N'-(2-butoxyethyl)-N'-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl]-N-methylhexane-1,6-diamine |
|---|---|
| PubChem CID | 174152095 |
| Molecular Formula | C23H50N2O5 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.37 |
| IUPAC Name | N'-(2-butoxyethyl)-N'-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl]-N-methylhexane-1,6-diamine |
| SMILES | CCCCOCCN(CCCCCCNC)CCOCCOCCOCCOCC |
| InChI | InChI=1S/C23H50N2O5/c1-4-6-15-27-16-13-25(12-10-8-7-9-11-24-3)14-17-28-20-21-30-23-22-29-19-18-26-5-2/h24H,4-23H2,1-3H3 |
| InChIKey | MGSMSFAUCJEHER-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|