C12H27NO2 — CID 91213413
N,N-bis(2-ethoxyethyl)butan-1-amine (PubChem CID 91213413) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)butan-1-amine.
| Compound Name | N,N-bis(2-ethoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 91213413 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)butan-1-amine |
| SMILES | CCCCN(CCOCC)CCOCC |
| InChI | InChI=1S/C12H27NO2/c1-4-7-8-13(9-11-14-5-2)10-12-15-6-3/h4-12H2,1-3H3 |
| InChIKey | DMMQPELFMKFPBM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|