C20H45N3O6 — CID 134252027
N,N-bis[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]butan-1-amine (PubChem CID 134252027) has the molecular formula C20H45N3O6 and a molecular weight of 423.60 g/mol. Its IUPAC name is N,N-bis[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]butan-1-amine.
| Compound Name | N,N-bis[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]butan-1-amine |
|---|---|
| PubChem CID | 134252027 |
| Molecular Formula | C20H45N3O6 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.33 |
| IUPAC Name | N,N-bis[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]butan-1-amine |
| SMILES | CCCCN(CCOCCOCCOCCN)CCOCCOCCOCCN |
| InChI | InChI=1S/C20H45N3O6/c1-2-3-6-23(7-11-26-15-19-28-17-13-24-9-4-21)8-12-27-16-20-29-18-14-25-10-5-22/h2-22H2,1H3 |
| InChIKey | PVDURQZVFQZBHP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 110.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|