C23H51N3O5 — CID 88853551
N'-(5-aminopentyl)-N'-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]pentane-1,5-diamine (PubChem CID 88853551) has the molecular formula C23H51N3O5 and a molecular weight of 449.68 g/mol. Its IUPAC name is N'-(5-aminopentyl)-N'-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]pentane-1,5-diamine.
| Compound Name | N'-(5-aminopentyl)-N'-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 88853551 |
| Molecular Formula | C23H51N3O5 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.38 |
| IUPAC Name | N'-(5-aminopentyl)-N'-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]pentane-1,5-diamine |
| SMILES | CCCOCCOCCOCCOCCOCCN(CCCCCN)CCCCCN |
| InChI | InChI=1S/C23H51N3O5/c1-2-14-27-16-18-29-20-22-31-23-21-30-19-17-28-15-13-26(11-7-3-5-9-24)12-8-4-6-10-25/h2-25H2,1H3 |
| InChIKey | VDDJYGHCRNYAKU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|