C22H46N2O6 — CID 174152090
N-(2-butoxyethyl)-3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-[4-(methylamino)butyl]propanamide (PubChem CID 174152090) has the molecular formula C22H46N2O6 and a molecular weight of 434.62 g/mol. Its IUPAC name is N-(2-butoxyethyl)-3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-[4-(methylamino)butyl]propanamide.
| Compound Name | N-(2-butoxyethyl)-3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-[4-(methylamino)butyl]propanamide |
|---|---|
| PubChem CID | 174152090 |
| Molecular Formula | C22H46N2O6 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | N-(2-butoxyethyl)-3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-N-[4-(methylamino)butyl]propanamide |
| SMILES | CCCCOCCN(CCCCNC)C(=O)CCOCCOCCOCCOCC |
| InChI | InChI=1S/C22H46N2O6/c1-4-6-13-27-15-12-24(11-8-7-10-23-3)22(25)9-14-28-18-19-30-21-20-29-17-16-26-5-2/h23H,4-21H2,1-3H3 |
| InChIKey | GBDKSDFPFHRJFU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|