C20H41NO3 — CID 87526086
N,N-bis(2-ethoxyethyl)dodecanamide (PubChem CID 87526086) has the molecular formula C20H41NO3 and a molecular weight of 343.55 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)dodecanamide.
| Compound Name | N,N-bis(2-ethoxyethyl)dodecanamide |
|---|---|
| PubChem CID | 87526086 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)dodecanamide |
| SMILES | CCCCCCCCCCCC(=O)N(CCOCC)CCOCC |
| InChI | InChI=1S/C20H41NO3/c1-4-7-8-9-10-11-12-13-14-15-20(22)21(16-18-23-5-2)17-19-24-6-3/h4-19H2,1-3H3 |
| InChIKey | FZZKWYFODQWBTN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|