C60H116N2O10 — CID 101425299
(Z)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N-[6-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl-[(Z)-octadec-9-enoyl]amino]hexyl]octadec-9-enamide (PubChem CID 101425299) has the molecular formula C60H116N2O10 and a molecular weight of 1025.59 g/mol. Its IUPAC name is (Z)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N-[6-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl-[(Z)-octadec-9-enoyl]amino]hexyl]octadec-9-enamide.
| Compound Name | (Z)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N-[6-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl-[(Z)-octadec-9-enoyl]amino]hexyl]octadec-9-enamide |
|---|---|
| PubChem CID | 101425299 |
| Molecular Formula | C60H116N2O10 |
| Molecular Weight | 1025.59 g/mol |
| Exact Mass | 1024.86 |
| IUPAC Name | (Z)-N-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N-[6-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl-[(Z)-octadec-9-enoyl]amino]hexyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(CCCCCCN(CCOCCOCCOCCOC)C(=O)CCCCCCC/C=C\CCCCCCCC)CCOCCOCCOCCOC |
| InChI | InChI=1S/C60H116N2O10/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-39-59(63)61(43-45-67-51-53-71-57-55-69-49-47-65-3)41-37-33-34-38-42-62(44-46-68-52-54-72-58-56-70-50-48-66-4)60(64)40-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22H,5-18,23-58H2,1-4H3/b21-19-,22-20- |
| InChIKey | JFGMVESUXWWBPG-WRBBJXAJSA-N |
| XLogP | 13.67 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 61 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.59 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|