C45H88N2O3 — CID 89427345
3-(dimethylamino)-N,N-bis[2-[(Z)-octadec-9-enoxy]ethyl]propanamide (PubChem CID 89427345) has the molecular formula C45H88N2O3 and a molecular weight of 705.21 g/mol. Its IUPAC name is 3-(dimethylamino)-N,N-bis[2-[(Z)-octadec-9-enoxy]ethyl]propanamide.
| Compound Name | 3-(dimethylamino)-N,N-bis[2-[(Z)-octadec-9-enoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 89427345 |
| Molecular Formula | C45H88N2O3 |
| Molecular Weight | 705.21 g/mol |
| Exact Mass | 704.68 |
| IUPAC Name | 3-(dimethylamino)-N,N-bis[2-[(Z)-octadec-9-enoxy]ethyl]propanamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCCN(CCOCCCCCCCC/C=C\CCCCCCCC)C(=O)CCN(C)C |
| InChI | InChI=1S/C45H88N2O3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41-49-43-39-47(45(48)37-38-46(3)4)40-44-50-42-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22H,5-18,23-44H2,1-4H3/b21-19-,22-20- |
| InChIKey | KAHUQGIDUOPPQR-WRBBJXAJSA-N |
| XLogP | 12.87 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.21 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|