C45H84N2O3 — CID 176648446
2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethoxy]ethyl 3-(dimethylamino)propanoate (PubChem CID 176648446) has the molecular formula C45H84N2O3 and a molecular weight of 701.18 g/mol. Its IUPAC name is 2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethoxy]ethyl 3-(dimethylamino)propanoate.
| Compound Name | 2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethoxy]ethyl 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 176648446 |
| Molecular Formula | C45H84N2O3 |
| Molecular Weight | 701.18 g/mol |
| Exact Mass | 700.65 |
| IUPAC Name | 2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethoxy]ethyl 3-(dimethylamino)propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C/C=C\CCCCC)CCOCCOC(=O)CCN(C)C |
| InChI | InChI=1S/C45H84N2O3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-47(41-42-49-43-44-50-45(48)37-40-46(3)4)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,5-12,17-18,23-44H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | VKSGIHLPBJVTQP-KWXKLSQISA-N |
| XLogP | 12.43 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.18 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|