C26H47NO4 — CID 143847746
2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 143847746) has the molecular formula C26H47NO4 and a molecular weight of 437.67 g/mol. Its IUPAC name is 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 143847746 |
| Molecular Formula | C26H47NO4 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.35 |
| IUPAC Name | 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCCOCCOCCN(C)C |
| InChI | InChI=1S/C26H47NO4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(28)31-25-24-30-23-22-29-21-20-27(2)3/h5-6,8-9,11-12H,4,7,10,13-25H2,1-3H3/b6-5-,9-8-,12-11- |
| InChIKey | NSVNXAUVPDAFKZ-AGRJPVHOSA-N |
| XLogP | 5.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|