C28H52NO3+ — CID 45110448
triethyl-[2-[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyethoxy]ethyl]azanium (PubChem CID 45110448) has the molecular formula C28H52NO3+ and a molecular weight of 450.73 g/mol. Its IUPAC name is triethyl-[2-[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyethoxy]ethyl]azanium.
| Compound Name | triethyl-[2-[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 45110448 |
| Molecular Formula | C28H52NO3+ |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | triethyl-[2-[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyethoxy]ethyl]azanium |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCCOCC[N+](CC)(CC)CC |
| InChI | InChI=1S/C28H52NO3/c1-5-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-28(30)32-27-26-31-25-24-29(6-2,7-3)8-4/h9-10,12-13,15-16H,5-8,11,14,17-27H2,1-4H3/q+1/b10-9-,13-12-,16-15- |
| InChIKey | SYIBBNDXMNUNOB-YOILPLPUSA-N |
| XLogP | 7.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|