C24H38O6S2 — CID 156698155
2-[[2-[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyethoxy]-2-oxoethyl]disulfanyl]acetic acid (PubChem CID 156698155) has the molecular formula C24H38O6S2 and a molecular weight of 486.70 g/mol. Its IUPAC name is 2-[[2-[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyethoxy]-2-oxoethyl]disulfanyl]acetic acid.
| Compound Name | 2-[[2-[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyethoxy]-2-oxoethyl]disulfanyl]acetic acid |
|---|---|
| PubChem CID | 156698155 |
| Molecular Formula | C24H38O6S2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[[2-[2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyethoxy]-2-oxoethyl]disulfanyl]acetic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCCOC(=O)CSSCC(=O)O |
| InChI | InChI=1S/C24H38O6S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(27)29-18-19-30-24(28)21-32-31-20-22(25)26/h3-4,6-7,9-10H,2,5,8,11-21H2,1H3,(H,25,26)/b4-3-,7-6-,10-9- |
| InChIKey | GXQMRSXHWJQSJE-PDBXOOCHSA-N |
| XLogP | 6.13 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|