C50H92N2O6 — CID 169300237
3-[methyl-[2-[2-[2-[methyl-[3-[(10E,13E)-octadeca-10,13-dienoyl]oxypropyl]amino]ethoxy]ethoxy]ethyl]amino]propyl (9E,12E)-octadeca-9,12-dienoate (PubChem CID 169300237) has the molecular formula C50H92N2O6 and a molecular weight of 817.29 g/mol. Its IUPAC name is 3-[methyl-[2-[2-[2-[methyl-[3-[(10E,13E)-octadeca-10,13-dienoyl]oxypropyl]amino]ethoxy]ethoxy]ethyl]amino]propyl (9E,12E)-octadeca-9,12-dienoate.
| Compound Name | 3-[methyl-[2-[2-[2-[methyl-[3-[(10E,13E)-octadeca-10,13-dienoyl]oxypropyl]amino]ethoxy]ethoxy]ethyl]amino]propyl (9E,12E)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 169300237 |
| Molecular Formula | C50H92N2O6 |
| Molecular Weight | 817.29 g/mol |
| Exact Mass | 816.70 |
| IUPAC Name | 3-[methyl-[2-[2-[2-[methyl-[3-[(10E,13E)-octadeca-10,13-dienoyl]oxypropyl]amino]ethoxy]ethoxy]ethyl]amino]propyl (9E,12E)-octadeca-9,12-dienoate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCCC(=O)OCCCN(C)CCOCCOCCN(C)CCCOC(=O)CCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C50H92N2O6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-49(53)57-43-35-39-51(3)41-45-55-47-48-56-46-42-52(4)40-36-44-58-50(54)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h11,13-14,16-17,19-20,22H,5-10,12,15,18,21,23-48H2,1-4H3/b13-11+,16-14+,19-17+,22-20+ |
| InChIKey | FCAJMNGCOOEKPF-VCXHTEFYSA-N |
| XLogP | 12.38 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.29 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|