C33H61NO7 — CID 89272529
2-[2-[methyl-[2-[2-[2-[(E)-undec-5-enoyl]oxyethoxy]ethoxy]ethyl]amino]ethoxy]ethyl (E)-undec-5-enoate (PubChem CID 89272529) has the molecular formula C33H61NO7 and a molecular weight of 583.85 g/mol. Its IUPAC name is 2-[2-[methyl-[2-[2-[2-[(E)-undec-5-enoyl]oxyethoxy]ethoxy]ethyl]amino]ethoxy]ethyl (E)-undec-5-enoate.
| Compound Name | 2-[2-[methyl-[2-[2-[2-[(E)-undec-5-enoyl]oxyethoxy]ethoxy]ethyl]amino]ethoxy]ethyl (E)-undec-5-enoate |
|---|---|
| PubChem CID | 89272529 |
| Molecular Formula | C33H61NO7 |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.44 |
| IUPAC Name | 2-[2-[methyl-[2-[2-[2-[(E)-undec-5-enoyl]oxyethoxy]ethoxy]ethyl]amino]ethoxy]ethyl (E)-undec-5-enoate |
| SMILES | CCCCC/C=C/CCCC(=O)OCCOCCOCCN(C)CCOCCOC(=O)CCC/C=C/CCCCC |
| InChI | InChI=1S/C33H61NO7/c1-4-6-8-10-12-14-16-18-20-32(35)40-30-28-38-25-23-34(3)22-24-37-26-27-39-29-31-41-33(36)21-19-17-15-13-11-9-7-5-2/h12-15H,4-11,16-31H2,1-3H3/b14-12+,15-13+ |
| InChIKey | KNYUDGYMSBBJPF-QUMQEAAQSA-N |
| XLogP | 6.67 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|