C24H48ClNO3 — CID 175136243
2-[2-(dimethylamino)ethoxy]ethyl (Z)-octadec-9-enoate;hydrochloride (PubChem CID 175136243) has the molecular formula C24H48ClNO3 and a molecular weight of 434.11 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]ethyl (Z)-octadec-9-enoate;hydrochloride.
| Compound Name | 2-[2-(dimethylamino)ethoxy]ethyl (Z)-octadec-9-enoate;hydrochloride |
|---|---|
| PubChem CID | 175136243 |
| Molecular Formula | C24H48ClNO3 |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]ethyl (Z)-octadec-9-enoate;hydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCOCCN(C)C.Cl |
| InChI | InChI=1S/C24H47NO3.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(26)28-23-22-27-21-20-25(2)3;/h11-12H,4-10,13-23H2,1-3H3;1H/b12-11-; |
| InChIKey | CKHLPUVPJRKSER-AFEZEDKISA-N |
| XLogP | 6.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|