About bis[2-(dimethylamino)ethyl] octadec-9-enedioate
bis[2-(dimethylamino)ethyl] octadec-9-enedioate (PubChem CID 123953757) has the molecular formula C26H50N2O4
and a molecular weight of 454.70 g/mol. Its IUPAC name is bis[2-(dimethylamino)ethyl] octadec-9-enedioate.
Molecular Properties
| Compound Name | bis[2-(dimethylamino)ethyl] octadec-9-enedioate |
| PubChem CID | 123953757 |
| Molecular Formula | C26H50N2O4 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | bis[2-(dimethylamino)ethyl] octadec-9-enedioate |
| SMILES | CN(C)CCOC(=O)CCCCCCCC=CCCCCCCCC(=O)OCCN(C)C |
| InChI | InChI=1S/C26H50N2O4/c1-27(2)21-23-31-25(29)19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-26(30)32-24-22-28(3)4/h5-6H,7-24H2,1-4H3 |
| InChIKey | UFWUNPKOLFERLQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(dimethylamino)ethyl] octadec-9-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(dimethylamino)ethyl] octadec-9-enedioate?
The IUPAC name of bis[2-(dimethylamino)ethyl] octadec-9-enedioate (CID 123953757) is bis[2-(dimethylamino)ethyl] octadec-9-enedioate.
What is the SMILES notation for bis[2-(dimethylamino)ethyl] octadec-9-enedioate?
The canonical SMILES for bis[2-(dimethylamino)ethyl] octadec-9-enedioate is CN(C)CCOC(=O)CCCCCCCC=CCCCCCCCC(=O)OCCN(C)C.
What is the InChIKey of bis[2-(dimethylamino)ethyl] octadec-9-enedioate?
The InChIKey is UFWUNPKOLFERLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H50N2O4/c1-27(2)21-23-31-25(29)19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-26(30)32-24-22-28(3)4/h5-6H,7-24H2,1-4H3.
What are the key properties of bis[2-(dimethylamino)ethyl] octadec-9-enedioate?
bis[2-(dimethylamino)ethyl] octadec-9-enedioate has a molecular weight of 454.70 g/mol, XLogP of 5.21, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(dimethylamino)ethyl] octadec-9-enedioate is sourced from PubChem (CID 123953757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).