C26H50N2O3 — CID 89285276
2-[4-(dimethylamino)butanoylamino]ethyl (Z)-octadec-9-enoate (PubChem CID 89285276) has the molecular formula C26H50N2O3 and a molecular weight of 438.70 g/mol. Its IUPAC name is 2-[4-(dimethylamino)butanoylamino]ethyl (Z)-octadec-9-enoate.
| Compound Name | 2-[4-(dimethylamino)butanoylamino]ethyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 89285276 |
| Molecular Formula | C26H50N2O3 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.38 |
| IUPAC Name | 2-[4-(dimethylamino)butanoylamino]ethyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCNC(=O)CCCN(C)C |
| InChI | InChI=1S/C26H50N2O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-26(30)31-24-22-27-25(29)20-19-23-28(2)3/h11-12H,4-10,13-24H2,1-3H3,(H,27,29)/b12-11- |
| InChIKey | GJIVPCTWBNPTIK-QXMHVHEDSA-N |
| XLogP | 6.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|