C21H39NO2S — CID 167093433
4-(dimethylamino)butyl (6Z,12Z)-15-sulfanylpentadeca-6,12-dienoate (PubChem CID 167093433) has the molecular formula C21H39NO2S and a molecular weight of 369.62 g/mol. Its IUPAC name is 4-(dimethylamino)butyl (6Z,12Z)-15-sulfanylpentadeca-6,12-dienoate.
| Compound Name | 4-(dimethylamino)butyl (6Z,12Z)-15-sulfanylpentadeca-6,12-dienoate |
|---|---|
| PubChem CID | 167093433 |
| Molecular Formula | C21H39NO2S |
| Molecular Weight | 369.62 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | 4-(dimethylamino)butyl (6Z,12Z)-15-sulfanylpentadeca-6,12-dienoate |
| SMILES | CN(C)CCCCOC(=O)CCCC/C=C\CCCC/C=C\CCS |
| InChI | InChI=1S/C21H39NO2S/c1-22(2)18-14-15-19-24-21(23)17-13-11-9-7-5-3-4-6-8-10-12-16-20-25/h5,7,10,12,25H,3-4,6,8-9,11,13-20H2,1-2H3/b7-5-,12-10- |
| InChIKey | JFJMOTRCDNLOON-PSVOIDRLSA-N |
| XLogP | 5.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|