About 3-(dimethylamino)propyl 3-sulfanylpropanoate
3-(dimethylamino)propyl 3-sulfanylpropanoate (PubChem CID 71427111) has the molecular formula C8H17NO2S
and a molecular weight of 191.30 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 3-sulfanylpropanoate |
| PubChem CID | 71427111 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 3-(dimethylamino)propyl 3-sulfanylpropanoate |
| SMILES | CN(C)CCCOC(=O)CCS |
| InChI | InChI=1S/C8H17NO2S/c1-9(2)5-3-6-11-8(10)4-7-12/h12H,3-7H2,1-2H3 |
| InChIKey | HIHVBQFTRJZJIE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 3-sulfanylpropanoate?
The IUPAC name of 3-(dimethylamino)propyl 3-sulfanylpropanoate (CID 71427111) is 3-(dimethylamino)propyl 3-sulfanylpropanoate.
What is the SMILES notation for 3-(dimethylamino)propyl 3-sulfanylpropanoate?
The canonical SMILES for 3-(dimethylamino)propyl 3-sulfanylpropanoate is CN(C)CCCOC(=O)CCS.
What is the InChIKey of 3-(dimethylamino)propyl 3-sulfanylpropanoate?
The InChIKey is HIHVBQFTRJZJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2S/c1-9(2)5-3-6-11-8(10)4-7-12/h12H,3-7H2,1-2H3.
What are the key properties of 3-(dimethylamino)propyl 3-sulfanylpropanoate?
3-(dimethylamino)propyl 3-sulfanylpropanoate has a molecular weight of 191.30 g/mol, XLogP of 0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 3-sulfanylpropanoate is sourced from PubChem (CID 71427111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).