About bis(butyl 3-sulfanylpropanoate);zinc
bis(butyl 3-sulfanylpropanoate);zinc (PubChem CID 87181906) has the molecular formula C14H28O4S2Zn
and a molecular weight of 389.90 g/mol. Its IUPAC name is bis(butyl 3-sulfanylpropanoate);zinc.
Molecular Properties
| Compound Name | bis(butyl 3-sulfanylpropanoate);zinc |
| PubChem CID | 87181906 |
| Molecular Formula | C14H28O4S2Zn |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | bis(butyl 3-sulfanylpropanoate);zinc |
| SMILES | CCCCOC(=O)CCS.CCCCOC(=O)CCS.[Zn] |
| InChI | InChI=1S/2C7H14O2S.Zn/c2*1-2-3-5-9-7(8)4-6-10;/h2*10H,2-6H2,1H3; |
| InChIKey | ZKUZGUHZYBDELY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(butyl 3-sulfanylpropanoate);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butyl 3-sulfanylpropanoate);zinc?
The IUPAC name of bis(butyl 3-sulfanylpropanoate);zinc (CID 87181906) is bis(butyl 3-sulfanylpropanoate);zinc.
What is the SMILES notation for bis(butyl 3-sulfanylpropanoate);zinc?
The canonical SMILES for bis(butyl 3-sulfanylpropanoate);zinc is CCCCOC(=O)CCS.CCCCOC(=O)CCS.[Zn].
What is the InChIKey of bis(butyl 3-sulfanylpropanoate);zinc?
The InChIKey is ZKUZGUHZYBDELY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H14O2S.Zn/c2*1-2-3-5-9-7(8)4-6-10;/h2*10H,2-6H2,1H3;.
What are the key properties of bis(butyl 3-sulfanylpropanoate);zinc?
bis(butyl 3-sulfanylpropanoate);zinc has a molecular weight of 389.90 g/mol, XLogP of 3.30, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butyl 3-sulfanylpropanoate);zinc is sourced from PubChem (CID 87181906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).