C44H84N2O6 — CID 171658871
2-[3-[3-(dimethylamino)propyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate (PubChem CID 171658871) has the molecular formula C44H84N2O6 and a molecular weight of 737.16 g/mol. Its IUPAC name is 2-[3-[3-(dimethylamino)propyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate.
| Compound Name | 2-[3-[3-(dimethylamino)propyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate |
|---|---|
| PubChem CID | 171658871 |
| Molecular Formula | C44H84N2O6 |
| Molecular Weight | 737.16 g/mol |
| Exact Mass | 736.63 |
| IUPAC Name | 2-[3-[3-(dimethylamino)propyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCN(C)C)CCC(=O)OCCOC(=O)CCC(OCCCCCC)OCCCCCC |
| InChI | InChI=1S/C44H84N2O6/c1-6-9-12-15-16-17-18-19-20-21-22-23-24-25-26-27-35-46(36-30-34-45(4)5)37-33-43(48)50-41-40-49-42(47)31-32-44(51-38-28-13-10-7-2)52-39-29-14-11-8-3/h16-17,19-20,44H,6-15,18,21-41H2,1-5H3/b17-16-,20-19- |
| InChIKey | BOOXCARQIMJNFY-LTXDKZCQSA-N |
| XLogP | 10.83 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.16 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|