C60H115NO7 — CID 88714122
2-[(Z)-octadec-9-enyl]peroxy-N,N-bis[2-[(Z)-octadec-9-enyl]peroxyethyl]acetamide (PubChem CID 88714122) has the molecular formula C60H115NO7 and a molecular weight of 962.58 g/mol. Its IUPAC name is 2-[(Z)-octadec-9-enyl]peroxy-N,N-bis[2-[(Z)-octadec-9-enyl]peroxyethyl]acetamide.
| Compound Name | 2-[(Z)-octadec-9-enyl]peroxy-N,N-bis[2-[(Z)-octadec-9-enyl]peroxyethyl]acetamide |
|---|---|
| PubChem CID | 88714122 |
| Molecular Formula | C60H115NO7 |
| Molecular Weight | 962.58 g/mol |
| Exact Mass | 961.87 |
| IUPAC Name | 2-[(Z)-octadec-9-enyl]peroxy-N,N-bis[2-[(Z)-octadec-9-enyl]peroxyethyl]acetamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOOCCN(CCOOCCCCCCCC/C=C\CCCCCCCC)C(=O)COOCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C60H115NO7/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-54-63-66-57-52-61(53-58-67-64-55-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)60(62)59-68-65-56-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h25-30H,4-24,31-59H2,1-3H3/b28-25-,29-26-,30-27- |
| InChIKey | ZTMFFBZAPOWEDP-IUPFWZBJSA-N |
| XLogP | 18.77 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 59 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.58 |
| LogP ≤ 5 | 18.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|