C38H72ClNO — CID 162712758
2-chloro-N,N-bis[(Z)-octadec-9-enyl]acetamide (PubChem CID 162712758) has the molecular formula C38H72ClNO and a molecular weight of 594.45 g/mol. Its IUPAC name is 2-chloro-N,N-bis[(Z)-octadec-9-enyl]acetamide.
| Compound Name | 2-chloro-N,N-bis[(Z)-octadec-9-enyl]acetamide |
|---|---|
| PubChem CID | 162712758 |
| Molecular Formula | C38H72ClNO |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 593.53 |
| IUPAC Name | 2-chloro-N,N-bis[(Z)-octadec-9-enyl]acetamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(CCCCCCCC/C=C\CCCCCCCC)C(=O)CCl |
| InChI | InChI=1S/C38H72ClNO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(38(41)37-39)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-37H2,1-2H3/b19-17-,20-18- |
| InChIKey | ZDGLHGMSHQMYIS-CLFAGFIQSA-N |
| XLogP | 13.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|