[(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid

C27H51NO2 — CID 118057935

IUPAC[(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC)C(=O)O
InChIInChI=1S/C27H51NO2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28(27(29)30)25-23-21-10-8-6-4-2/h11-12,14-15H,3-10,13,16-26H2,1-2H3,(H,29,30)/b12-11-,15-14-
InChIKeySNCSAFXSOKNPQY-HDXUUTQWSA-N
MW421.71 g/mol
LogP9.14
Rot. Bonds22

About [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid

[(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid (PubChem CID 118057935) has the molecular formula C27H51NO2 and a molecular weight of 421.71 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid.

Molecular Properties

Compound Name[(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid
PubChem CID118057935
Molecular FormulaC27H51NO2
Molecular Weight421.71 g/mol
Exact Mass421.39
IUPAC Name[(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC)C(=O)O
InChIInChI=1S/C27H51NO2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28(27(29)30)25-23-21-10-8-6-4-2/h11-12,14-15H,3-10,13,16-26H2,1-2H3,(H,29,30)/b12-11-,15-14-
InChIKeySNCSAFXSOKNPQY-HDXUUTQWSA-N
XLogP9.14
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds22
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500421.71
LogP ≤ 59.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid?
The IUPAC name of [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid (CID 118057935) is [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid.
What is the SMILES notation for [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid?
The canonical SMILES for [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid is CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC)C(=O)O.
What is the InChIKey of [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid?
The InChIKey is SNCSAFXSOKNPQY-HDXUUTQWSA-N. The full InChI is InChI=1S/C27H51NO2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28(27(29)30)25-23-21-10-8-6-4-2/h11-12,14-15H,3-10,13,16-26H2,1-2H3,(H,29,30)/b12-11-,15-14-.
What are the key properties of [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid?
[(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid has a molecular weight of 421.71 g/mol, XLogP of 9.14, 22 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(9Z,12Z)-octadeca-9,12-dienyl]-octylcarbamic acid is sourced from PubChem (CID 118057935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).