C36H67NO — CID 134498270
N,N-bis[(9Z,12Z)-octadeca-9,12-dienyl]hydroxylamine (PubChem CID 134498270) has the molecular formula C36H67NO and a molecular weight of 529.94 g/mol. Its IUPAC name is N,N-bis[(9Z,12Z)-octadeca-9,12-dienyl]hydroxylamine.
| Compound Name | N,N-bis[(9Z,12Z)-octadeca-9,12-dienyl]hydroxylamine |
|---|---|
| PubChem CID | 134498270 |
| Molecular Formula | C36H67NO |
| Molecular Weight | 529.94 g/mol |
| Exact Mass | 529.52 |
| IUPAC Name | N,N-bis[(9Z,12Z)-octadeca-9,12-dienyl]hydroxylamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(O)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C36H67NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37(38)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,38H,3-10,15-16,21-36H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | GGPMQRHQANDUDZ-MAZCIEHSSA-N |
| XLogP | 12.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.94 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|