About 2-chloro-N,N-di(nonyl)acetamide
2-chloro-N,N-di(nonyl)acetamide (PubChem CID 533173) has the molecular formula C20H40ClNO
and a molecular weight of 346.00 g/mol. Its IUPAC name is 2-chloro-N,N-di(nonyl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N,N-di(nonyl)acetamide |
| PubChem CID | 533173 |
| Molecular Formula | C20H40ClNO |
| Molecular Weight | 346.00 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | 2-chloro-N,N-di(nonyl)acetamide |
| SMILES | CCCCCCCCCN(CCCCCCCCC)C(=O)CCl |
| InChI | InChI=1S/C20H40ClNO/c1-3-5-7-9-11-13-15-17-22(20(23)19-21)18-16-14-12-10-8-6-4-2/h3-19H2,1-2H3 |
| InChIKey | MPFKIPYWOBSVSB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.00 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-di(nonyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-di(nonyl)acetamide?
The IUPAC name of 2-chloro-N,N-di(nonyl)acetamide (CID 533173) is 2-chloro-N,N-di(nonyl)acetamide.
What is the SMILES notation for 2-chloro-N,N-di(nonyl)acetamide?
The canonical SMILES for 2-chloro-N,N-di(nonyl)acetamide is CCCCCCCCCN(CCCCCCCCC)C(=O)CCl.
What is the InChIKey of 2-chloro-N,N-di(nonyl)acetamide?
The InChIKey is MPFKIPYWOBSVSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40ClNO/c1-3-5-7-9-11-13-15-17-22(20(23)19-21)18-16-14-12-10-8-6-4-2/h3-19H2,1-2H3.
What are the key properties of 2-chloro-N,N-di(nonyl)acetamide?
2-chloro-N,N-di(nonyl)acetamide has a molecular weight of 346.00 g/mol, XLogP of 6.55, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-di(nonyl)acetamide is sourced from PubChem (CID 533173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).