C42H80N2O3 — CID 123192613
3-(dimethylamino)propyl N-(2-hexadec-9-enoxyethyl)-N-octadeca-9,12-dienylcarbamate (PubChem CID 123192613) has the molecular formula C42H80N2O3 and a molecular weight of 661.11 g/mol. Its IUPAC name is 3-(dimethylamino)propyl N-(2-hexadec-9-enoxyethyl)-N-octadeca-9,12-dienylcarbamate.
| Compound Name | 3-(dimethylamino)propyl N-(2-hexadec-9-enoxyethyl)-N-octadeca-9,12-dienylcarbamate |
|---|---|
| PubChem CID | 123192613 |
| Molecular Formula | C42H80N2O3 |
| Molecular Weight | 661.11 g/mol |
| Exact Mass | 660.62 |
| IUPAC Name | 3-(dimethylamino)propyl N-(2-hexadec-9-enoxyethyl)-N-octadeca-9,12-dienylcarbamate |
| SMILES | CCCCCC=CCC=CCCCCCCCCN(CCOCCCCCCCCC=CCCCCCC)C(=O)OCCCN(C)C |
| InChI | InChI=1S/C42H80N2O3/c1-5-7-9-11-13-15-17-19-21-22-23-25-27-29-31-33-37-44(42(45)47-40-35-36-43(3)4)38-41-46-39-34-32-30-28-26-24-20-18-16-14-12-10-8-6-2/h13,15-16,18-19,21H,5-12,14,17,20,22-41H2,1-4H3 |
| InChIKey | FUJZJPFLAMJWLA-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.11 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|