C41H75NO3 — CID 118057450
4-hydroxybutyl N,N-bis[(9Z,12Z)-octadeca-9,12-dienyl]carbamate (PubChem CID 118057450) has the molecular formula C41H75NO3 and a molecular weight of 630.06 g/mol. Its IUPAC name is 4-hydroxybutyl N,N-bis[(9Z,12Z)-octadeca-9,12-dienyl]carbamate.
| Compound Name | 4-hydroxybutyl N,N-bis[(9Z,12Z)-octadeca-9,12-dienyl]carbamate |
|---|---|
| PubChem CID | 118057450 |
| Molecular Formula | C41H75NO3 |
| Molecular Weight | 630.06 g/mol |
| Exact Mass | 629.57 |
| IUPAC Name | 4-hydroxybutyl N,N-bis[(9Z,12Z)-octadeca-9,12-dienyl]carbamate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C/C=C\CCCCC)C(=O)OCCCCO |
| InChI | InChI=1S/C41H75NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-42(41(44)45-40-36-35-39-43)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,43H,3-10,15-16,21-40H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | VTNIIQZSGYEZQZ-MAZCIEHSSA-N |
| XLogP | 12.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.06 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|