C14H29NO2 — CID 176838101
N,N-diethyl-4-hexoxybutanamide (PubChem CID 176838101) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is N,N-diethyl-4-hexoxybutanamide.
| Compound Name | N,N-diethyl-4-hexoxybutanamide |
|---|---|
| PubChem CID | 176838101 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | N,N-diethyl-4-hexoxybutanamide |
| SMILES | CCCCCCOCCCC(=O)N(CC)CC |
| InChI | InChI=1S/C14H29NO2/c1-4-7-8-9-12-17-13-10-11-14(16)15(5-2)6-3/h4-13H2,1-3H3 |
| InChIKey | MJIUCDQSZOORSB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|